C17H28IN3O — CID 110956437
N-ethyl-N'-[3-(3-methoxyphenyl)propyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110956437) has the molecular formula C17H28IN3O and a molecular weight of 417.34 g/mol. Its IUPAC name is N-ethyl-N'-[3-(3-methoxyphenyl)propyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(3-methoxyphenyl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110956437 |
| Molecular Formula | C17H28IN3O |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-ethyl-N'-[3-(3-methoxyphenyl)propyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCc1cccc(OC)c1)N1CCCC1.I |
| InChI | InChI=1S/C17H27N3O.HI/c1-3-18-17(20-12-4-5-13-20)19-11-7-9-15-8-6-10-16(14-15)21-2;/h6,8,10,14H,3-5,7,9,11-13H2,1-2H3,(H,18,19);1H |
| InChIKey | GEHDODFWSSFGKF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|