C21H28N4O3 — CID 111166181
N-ethyl-4-(furan-2-carbonyl)-N'-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboximidamide (PubChem CID 111166181) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-carbonyl)-N'-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(furan-2-carbonyl)-N'-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111166181 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-ethyl-4-(furan-2-carbonyl)-N'-[2-(3-methoxyphenyl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cccc(OC)c1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-3-22-21(23-10-9-17-6-4-7-18(16-17)27-2)25-13-11-24(12-14-25)20(26)19-8-5-15-28-19/h4-8,15-16H,3,9-14H2,1-2H3,(H,22,23) |
| InChIKey | SLFHOHKMENKABK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|