C19H25N5O2 — CID 111167753
N-ethyl-4-(furan-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide (PubChem CID 111167753) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide.
| Compound Name | N-ethyl-4-(furan-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167753 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-ethyl-4-(furan-2-carbonyl)-N'-(2-pyridin-3-ylethyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCc1cccnc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H25N5O2/c1-2-21-19(22-9-7-16-5-3-8-20-15-16)24-12-10-23(11-13-24)18(25)17-6-4-14-26-17/h3-6,8,14-15H,2,7,9-13H2,1H3,(H,21,22) |
| InChIKey | FMGDRHGFAZTPPI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|