C17H24IN5O2S — CID 119130504
N-ethyl-4-(furan-2-carbonyl)-N'-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 119130504) has the molecular formula C17H24IN5O2S and a molecular weight of 489.38 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-carbonyl)-N'-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(furan-2-carbonyl)-N'-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119130504 |
| Molecular Formula | C17H24IN5O2S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-ethyl-4-(furan-2-carbonyl)-N'-[2-(1,3-thiazol-2-yl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nccs1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C17H23N5O2S.HI/c1-2-18-17(20-6-5-15-19-7-13-25-15)22-10-8-21(9-11-22)16(23)14-4-3-12-24-14;/h3-4,7,12-13H,2,5-6,8-11H2,1H3,(H,18,20);1H |
| InChIKey | HXNIQNPQOSWGSS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|