C17H27IN4O2S — CID 111169001
N-ethyl-4-(furan-2-carbonyl)-N'-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111169001) has the molecular formula C17H27IN4O2S and a molecular weight of 478.40 g/mol. Its IUPAC name is N-ethyl-4-(furan-2-carbonyl)-N'-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-4-(furan-2-carbonyl)-N'-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111169001 |
| Molecular Formula | C17H27IN4O2S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-ethyl-4-(furan-2-carbonyl)-N'-(2-prop-2-enylsulfanylethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CCSCC/N=C(\NCC)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C17H26N4O2S.HI/c1-3-13-24-14-7-19-17(18-4-2)21-10-8-20(9-11-21)16(22)15-6-5-12-23-15;/h3,5-6,12H,1,4,7-11,13-14H2,2H3,(H,18,19);1H |
| InChIKey | SGPRRRZZEDDRNK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|