C17H29IN4O2 — CID 119130492
N'-(2,2-dimethylpropyl)-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119130492) has the molecular formula C17H29IN4O2 and a molecular weight of 448.35 g/mol. Its IUPAC name is N'-(2,2-dimethylpropyl)-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2,2-dimethylpropyl)-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119130492 |
| Molecular Formula | C17H29IN4O2 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N'-(2,2-dimethylpropyl)-N-ethyl-4-(furan-2-carbonyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)C)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C17H28N4O2.HI/c1-5-18-16(19-13-17(2,3)4)21-10-8-20(9-11-21)15(22)14-7-6-12-23-14;/h6-7,12H,5,8-11,13H2,1-4H3,(H,18,19);1H |
| InChIKey | IHTRTCUIPKPTLF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|