C20H34IN5O4 — CID 111167622
tert-butyl N-[2-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide (PubChem CID 111167622) has the molecular formula C20H34IN5O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111167622 |
| Molecular Formula | C20H34IN5O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | tert-butyl N-[2-[[ethylamino-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]amino]ethyl]-N-methylcarbamate;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)C(=O)OC(C)(C)C)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C20H33N5O4.HI/c1-6-21-18(22-9-10-23(5)19(27)29-20(2,3)4)25-13-11-24(12-14-25)17(26)16-8-7-15-28-16;/h7-8,15H,6,9-14H2,1-5H3,(H,21,22);1H |
| InChIKey | DILYIOABKGFBSC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|