C20H33N5O4 — CID 111169000
tert-butyl N-ethyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate (PubChem CID 111169000) has the molecular formula C20H33N5O4 and a molecular weight of 407.52 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111169000 |
| Molecular Formula | C20H33N5O4 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | tert-butyl N-ethyl-N-[2-[[C-[4-(furan-2-carbonyl)piperazin-1-yl]-N-methylcarbonimidoyl]amino]ethyl]carbamate |
| SMILES | CCN(CCN/C(=N\C)N1CCN(C(=O)c2ccco2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H33N5O4/c1-6-23(19(27)29-20(2,3)4)10-9-22-18(21-5)25-13-11-24(12-14-25)17(26)16-8-7-15-28-16/h7-8,15H,6,9-14H2,1-5H3,(H,21,22) |
| InChIKey | LCYQNWCIYHBGPT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 90.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|