C14H20F3IN4O2S — CID 119130496
4-(furan-2-carbonyl)-N'-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 119130496) has the molecular formula C14H20F3IN4O2S and a molecular weight of 492.31 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119130496 |
| Molecular Formula | C14H20F3IN4O2S |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCSC(F)(F)F)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C14H19F3N4O2S.HI/c1-18-13(19-4-10-24-14(15,16)17)21-7-5-20(6-8-21)12(22)11-3-2-9-23-11;/h2-3,9H,4-8,10H2,1H3,(H,18,19);1H |
| InChIKey | ILBAONVTXHRNNL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|