C21H26F3IN4O3 — CID 111167314
4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111167314) has the molecular formula C21H26F3IN4O3 and a molecular weight of 566.36 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111167314 |
| Molecular Formula | C21H26F3IN4O3 |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(COCC(F)(F)F)cc1)N1CCN(C(=O)c2ccco2)CC1.I |
| InChI | InChI=1S/C21H25F3N4O3.HI/c1-25-20(28-10-8-27(9-11-28)19(29)18-3-2-12-31-18)26-13-16-4-6-17(7-5-16)14-30-15-21(22,23)24;/h2-7,12H,8-11,13-15H2,1H3,(H,25,26);1H |
| InChIKey | HOQKJMIMKFYNPR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|