C24H35N5O3 — CID 111168861
N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111168861) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111168861 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCN(CC)CCOc1ccc(CN/C(=N\C)N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C24H35N5O3/c1-4-27(5-2)16-18-31-21-10-8-20(9-11-21)19-26-24(25-3)29-14-12-28(13-15-29)23(30)22-7-6-17-32-22/h6-11,17H,4-5,12-16,18-19H2,1-3H3,(H,25,26) |
| InChIKey | KCHYAEPPFPZHLT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|