C23H24FN5O3 — CID 111168857
N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111168857) has the molecular formula C23H24FN5O3 and a molecular weight of 437.48 g/mol. Its IUPAC name is N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111168857 |
| Molecular Formula | C23H24FN5O3 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-4-(furan-2-carbonyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(Oc2ccc(F)cc2)nc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C23H24FN5O3/c1-25-23(29-12-10-28(11-13-29)22(30)20-3-2-14-31-20)27-16-17-4-9-21(26-15-17)32-19-7-5-18(24)6-8-19/h2-9,14-15H,10-13,16H2,1H3,(H,25,27) |
| InChIKey | VQUKVJYGZUYTOL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|