C21H19FN4O4 — CID 52627337
N-[6-(4-fluorophenoxy)-3-pyridinyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide (PubChem CID 52627337) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is N-[6-(4-fluorophenoxy)-3-pyridinyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 52627337 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[6-(4-fluorophenoxy)-3-pyridinyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(F)cc2)nc1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C21H19FN4O4/c22-15-3-6-17(7-4-15)30-19-8-5-16(14-23-19)24-21(28)26-11-9-25(10-12-26)20(27)18-2-1-13-29-18/h1-8,13-14H,9-12H2,(H,24,28) |
| InChIKey | OQPIKRGVXHUYOH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |