C18H16FN3O4 — CID 86994318
1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 86994318) has the molecular formula C18H16FN3O4 and a molecular weight of 357.34 g/mol. Its IUPAC name is 1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 86994318 |
| Molecular Formula | C18H16FN3O4 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-[6-(4-fluorophenoxy)-3-pyridinyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccco1)Nc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C18H16FN3O4/c19-12-3-6-14(7-4-12)26-17-8-5-13(10-20-17)22-18(24)21-11-15(23)16-2-1-9-25-16/h1-10,15,23H,11H2,(H2,21,22,24) |
| InChIKey | HHRPRRMCVDLIND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |