C14H13F3N2O4 — CID 110891153
1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 110891153) has the molecular formula C14H13F3N2O4 and a molecular weight of 330.26 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 110891153 |
| Molecular Formula | C14H13F3N2O4 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCC(O)c1ccco1)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H13F3N2O4/c15-14(16,17)23-10-4-1-3-9(7-10)19-13(21)18-8-11(20)12-5-2-6-22-12/h1-7,11,20H,8H2,(H2,18,19,21) |
| InChIKey | FSEMOWADRDZHEV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |