C14H15ClN2O3 — CID 86980282
1-(3-chloro-4-methylphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 86980282) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-(3-chloro-4-methylphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 86980282 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCC(O)c2ccco2)cc1Cl |
| InChI | InChI=1S/C14H15ClN2O3/c1-9-4-5-10(7-11(9)15)17-14(19)16-8-12(18)13-3-2-6-20-13/h2-7,12,18H,8H2,1H3,(H2,16,17,19) |
| InChIKey | MDHMWRFPQBPGQZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |