C13H12ClN3O5 — CID 110890610
1-(4-chloro-3-nitrophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 110890610) has the molecular formula C13H12ClN3O5 and a molecular weight of 325.71 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110890610 |
| Molecular Formula | C13H12ClN3O5 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccco1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12ClN3O5/c14-9-4-3-8(6-10(9)17(20)21)16-13(19)15-7-11(18)12-2-1-5-22-12/h1-6,11,18H,7H2,(H2,15,16,19) |
| InChIKey | VOFIUOOZPNMBII-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|