C13H13BrN2O3 — CID 110890281
1-(4-bromophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 110890281) has the molecular formula C13H13BrN2O3 and a molecular weight of 325.16 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110890281 |
| Molecular Formula | C13H13BrN2O3 |
| Molecular Weight | 325.16 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 1-(4-bromophenyl)-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccco1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H13BrN2O3/c14-9-3-5-10(6-4-9)16-13(18)15-8-11(17)12-2-1-7-19-12/h1-7,11,17H,8H2,(H2,15,16,18) |
| InChIKey | WHLSAFPFXMBUOA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |