C18H22N2O5 — CID 86993724
butyl 4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate (PubChem CID 86993724) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is butyl 4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate.
| Compound Name | butyl 4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 86993724 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | butyl 4-[[2-(furan-2-yl)-2-hydroxyethyl]carbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)NCC(O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H22N2O5/c1-2-3-10-25-17(22)13-6-8-14(9-7-13)20-18(23)19-12-15(21)16-5-4-11-24-16/h4-9,11,15,21H,2-3,10,12H2,1H3,(H2,19,20,23) |
| InChIKey | RTYNFRLETCYNTG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|