C18H19NO6 — CID 2631611
[2-(4-butoxycarbonylanilino)-2-oxoethyl] furan-2-carboxylate (PubChem CID 2631611) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is [2-(4-butoxycarbonylanilino)-2-oxoethyl] furan-2-carboxylate.
| Compound Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2631611 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] furan-2-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H19NO6/c1-2-3-10-24-17(21)13-6-8-14(9-7-13)19-16(20)12-25-18(22)15-5-4-11-23-15/h4-9,11H,2-3,10,12H2,1H3,(H,19,20) |
| InChIKey | PJDDGVDMWPCSJM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|