C13H12N2O6S — CID 2389466
[2-oxo-2-(4-sulfamoylanilino)ethyl] furan-2-carboxylate (PubChem CID 2389466) has the molecular formula C13H12N2O6S and a molecular weight of 324.31 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] furan-2-carboxylate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2389466 |
| Molecular Formula | C13H12N2O6S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] furan-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C13H12N2O6S/c14-22(18,19)10-5-3-9(4-6-10)15-12(16)8-21-13(17)11-2-1-7-20-11/h1-7H,8H2,(H,15,16)(H2,14,18,19) |
| InChIKey | GBVWOQFYDMDVAW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |