C15H16N2O6S — CID 7891668
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] furan-2-carboxylate (PubChem CID 7891668) has the molecular formula C15H16N2O6S and a molecular weight of 352.37 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] furan-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 7891668 |
| Molecular Formula | C15H16N2O6S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] furan-2-carboxylate |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)COC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C15H16N2O6S/c16-24(20,21)12-5-3-11(4-6-12)7-8-17-14(18)10-23-15(19)13-2-1-9-22-13/h1-6,9H,7-8,10H2,(H,17,18)(H2,16,20,21) |
| InChIKey | ULRICMJPMPEYQX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |