C15H20N2O5S — CID 8759577
[2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-methylbut-2-enoate (PubChem CID 8759577) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-methylbut-2-enoate.
| Compound Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 8759577 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [2-oxo-2-[2-(4-sulfamoylphenyl)ethylamino]ethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H20N2O5S/c1-11(2)9-15(19)22-10-14(18)17-8-7-12-3-5-13(6-4-12)23(16,20)21/h3-6,9H,7-8,10H2,1-2H3,(H,17,18)(H2,16,20,21) |
| InChIKey | ROYISMDXMOARSY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|