C11H17N3O5S2 — CID 112993993
2-(methanesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide (PubChem CID 112993993) has the molecular formula C11H17N3O5S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(methanesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide.
| Compound Name | 2-(methanesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 112993993 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-(methanesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide |
| SMILES | CS(=O)(=O)NCC(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H17N3O5S2/c1-20(16,17)14-8-11(15)13-7-6-9-2-4-10(5-3-9)21(12,18)19/h2-5,14H,6-8H2,1H3,(H,13,15)(H2,12,18,19) |
| InChIKey | HUHPTZYEEVFDBG-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |