C17H21N3O5S2 — CID 27538225
3-(benzenesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 27538225) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 27538225 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)CCNS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N3O5S2/c18-26(22,23)15-8-6-14(7-9-15)10-12-19-17(21)11-13-20-27(24,25)16-4-2-1-3-5-16/h1-9,20H,10-13H2,(H,19,21)(H2,18,22,23) |
| InChIKey | KLCDGIUIECPXBI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |