C18H23N3O5S2 — CID 33426034
N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-(4-sulfamoylphenyl)propanamide (PubChem CID 33426034) has the molecular formula C18H23N3O5S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-(4-sulfamoylphenyl)propanamide.
| Compound Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 33426034 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[2-[(4-methylphenyl)sulfonylamino]ethyl]-3-(4-sulfamoylphenyl)propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CCc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H23N3O5S2/c1-14-2-7-17(8-3-14)28(25,26)21-13-12-20-18(22)11-6-15-4-9-16(10-5-15)27(19,23)24/h2-5,7-10,21H,6,11-13H2,1H3,(H,20,22)(H2,19,23,24) |
| InChIKey | VJAPIDAMKVXXQJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|