C11H16N2O3S — CID 47109333
N-ethyl-3-(4-sulfamoylphenyl)propanamide (PubChem CID 47109333) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is N-ethyl-3-(4-sulfamoylphenyl)propanamide.
| Compound Name | N-ethyl-3-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 47109333 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-ethyl-3-(4-sulfamoylphenyl)propanamide |
| SMILES | CCNC(=O)CCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H16N2O3S/c1-2-13-11(14)8-5-9-3-6-10(7-4-9)17(12,15)16/h3-4,6-7H,2,5,8H2,1H3,(H,13,14)(H2,12,15,16) |
| InChIKey | CHJXTVMACVAPRK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |