C11H17N3O2S2 — CID 748226
1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 748226) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 748226 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-ethyl-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | CCNC(=S)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H17N3O2S2/c1-2-13-11(17)14-8-7-9-3-5-10(6-4-9)18(12,15)16/h3-6H,2,7-8H2,1H3,(H2,12,15,16)(H2,13,14,17) |
| InChIKey | UVPGBWVGVQACKF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|