C14H15N3O3S3 — CID 2271589
N-[2-(4-sulfamoylphenyl)ethylcarbamothioyl]thiophene-2-carboxamide (PubChem CID 2271589) has the molecular formula C14H15N3O3S3 and a molecular weight of 369.49 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethylcarbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethylcarbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2271589 |
| Molecular Formula | C14H15N3O3S3 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethylcarbamothioyl]thiophene-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=S)NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H15N3O3S3/c15-23(19,20)11-5-3-10(4-6-11)7-8-16-14(21)17-13(18)12-2-1-9-22-12/h1-6,9H,7-8H2,(H2,15,19,20)(H2,16,17,18,21) |
| InChIKey | KUJKHYWDQYSCEK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|