C16H15N3O4S2 — CID 18272294
N-[2-(4-sulfamoylphenyl)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 18272294) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[2-(4-sulfamoylphenyl)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-(4-sulfamoylphenyl)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 18272294 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-[2-(4-sulfamoylphenyl)ethyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2cc(-c3cccs3)on2)cc1 |
| InChI | InChI=1S/C16H15N3O4S2/c17-25(21,22)12-5-3-11(4-6-12)7-8-18-16(20)13-10-14(23-19-13)15-2-1-9-24-15/h1-6,9-10H,7-8H2,(H,18,20)(H2,17,21,22) |
| InChIKey | ODZKETFLYXWBGO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |