C20H18N4O4S2 — CID 44628153
7-hydroxy-N-[2-(4-sulfamoylphenyl)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide (PubChem CID 44628153) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 7-hydroxy-N-[2-(4-sulfamoylphenyl)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide.
| Compound Name | 7-hydroxy-N-[2-(4-sulfamoylphenyl)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 44628153 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 7-hydroxy-N-[2-(4-sulfamoylphenyl)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=O)c2ccc(O)c3[nH]c(-c4cccs4)nc23)cc1 |
| InChI | InChI=1S/C20H18N4O4S2/c21-30(27,28)13-5-3-12(4-6-13)9-10-22-20(26)14-7-8-15(25)18-17(14)23-19(24-18)16-2-1-11-29-16/h1-8,11,25H,9-10H2,(H,22,26)(H,23,24)(H2,21,27,28) |
| InChIKey | FLPCFXRGUFUVHJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |