C20H15F3N4O3S — CID 44628456
7-hydroxy-2-thiophen-2-yl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1H-benzimidazole-4-carboxamide (PubChem CID 44628456) has the molecular formula C20H15F3N4O3S and a molecular weight of 448.43 g/mol. Its IUPAC name is 7-hydroxy-2-thiophen-2-yl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 7-hydroxy-2-thiophen-2-yl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 44628456 |
| Molecular Formula | C20H15F3N4O3S |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 7-hydroxy-2-thiophen-2-yl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(C(F)(F)F)cn1)c1ccc(O)c2[nH]c(-c3cccs3)nc12 |
| InChI | InChI=1S/C20H15F3N4O3S/c21-20(22,23)11-3-6-15(25-10-11)30-8-7-24-19(29)12-4-5-13(28)17-16(12)26-18(27-17)14-2-1-9-31-14/h1-6,9-10,28H,7-8H2,(H,24,29)(H,26,27) |
| InChIKey | VDTJTBXXNGFVFO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|