C20H16N4O5S — CID 44628156
7-hydroxy-N-[2-(4-nitrophenoxy)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide (PubChem CID 44628156) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is 7-hydroxy-N-[2-(4-nitrophenoxy)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide.
| Compound Name | 7-hydroxy-N-[2-(4-nitrophenoxy)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 44628156 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 7-hydroxy-N-[2-(4-nitrophenoxy)ethyl]-2-thiophen-2-yl-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc([N+](=O)[O-])cc1)c1ccc(O)c2[nH]c(-c3cccs3)nc12 |
| InChI | InChI=1S/C20H16N4O5S/c25-15-8-7-14(17-18(15)23-19(22-17)16-2-1-11-30-16)20(26)21-9-10-29-13-5-3-12(4-6-13)24(27)28/h1-8,11,25H,9-10H2,(H,21,26)(H,22,23) |
| InChIKey | BBIVHOWFUCOWKO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|