C14H10F3N3O2S — CID 71969634
3-cyano-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]thiophene-2-carboxamide (PubChem CID 71969634) has the molecular formula C14H10F3N3O2S and a molecular weight of 341.31 g/mol. Its IUPAC name is 3-cyano-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]thiophene-2-carboxamide.
| Compound Name | 3-cyano-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71969634 |
| Molecular Formula | C14H10F3N3O2S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-cyano-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]thiophene-2-carboxamide |
| SMILES | N#Cc1ccsc1C(=O)NCCOc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H10F3N3O2S/c15-14(16,17)10-1-2-11(20-8-10)22-5-4-19-13(21)12-9(7-18)3-6-23-12/h1-3,6,8H,4-5H2,(H,19,21) |
| InChIKey | VSXWPHSQSZXZEZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|