C18H18F6N2O3 — CID 57449137
5-(trifluoromethyl)-2-[3-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]propoxy]pyridine (PubChem CID 57449137) has the molecular formula C18H18F6N2O3 and a molecular weight of 424.34 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-[3-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]propoxy]pyridine.
| Compound Name | 5-(trifluoromethyl)-2-[3-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]propoxy]pyridine |
|---|---|
| PubChem CID | 57449137 |
| Molecular Formula | C18H18F6N2O3 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-(trifluoromethyl)-2-[3-[3-[[5-(trifluoromethyl)-2-pyridinyl]oxy]propoxy]propoxy]pyridine |
| SMILES | FC(F)(F)c1ccc(OCCCOCCCOc2ccc(C(F)(F)F)cn2)nc1 |
| InChI | InChI=1S/C18H18F6N2O3/c19-17(20,21)13-3-5-15(25-11-13)28-9-1-7-27-8-2-10-29-16-6-4-14(12-26-16)18(22,23)24/h3-6,11-12H,1-2,7-10H2 |
| InChIKey | HZTZQXIQEUKCQN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|