C13H18F3IN4O — CID 110031641
1-cyclopropyl-1-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide (PubChem CID 110031641) has the molecular formula C13H18F3IN4O and a molecular weight of 430.21 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110031641 |
| Molecular Formula | C13H18F3IN4O |
| Molecular Weight | 430.21 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxy]ethyl]guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCOc1ccc(C(F)(F)F)cn1)C1CC1.I |
| InChI | InChI=1S/C13H17F3N4O.HI/c1-20(10-3-4-10)12(17)18-6-7-21-11-5-2-9(8-19-11)13(14,15)16;/h2,5,8,10H,3-4,6-7H2,1H3,(H2,17,18);1H |
| InChIKey | XWPDDWHFJGXOCS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|