C17H20FIN4O — CID 110030789
1-cyclopropyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-1-methylguanidine;hydroiodide (PubChem CID 110030789) has the molecular formula C17H20FIN4O and a molecular weight of 442.28 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110030789 |
| Molecular Formula | C17H20FIN4O |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 1-cyclopropyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/Cc1ccc(Oc2cccc(F)c2)nc1)C1CC1.I |
| InChI | InChI=1S/C17H19FN4O.HI/c1-22(14-6-7-14)17(19)21-11-12-5-8-16(20-10-12)23-15-4-2-3-13(18)9-15;/h2-5,8-10,14H,6-7,11H2,1H3,(H2,19,21);1H |
| InChIKey | IOWSONHKQXQNQK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|