C18H22FIN4O — CID 110981310
1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110981310) has the molecular formula C18H22FIN4O and a molecular weight of 456.30 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110981310 |
| Molecular Formula | C18H22FIN4O |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/Cc1ccc(Oc2cccc(F)c2)nc1)NCC.I |
| InChI | InChI=1S/C18H21FN4O.HI/c1-3-10-21-18(20-4-2)23-13-14-8-9-17(22-12-14)24-16-7-5-6-15(19)11-16;/h3,5-9,11-12H,1,4,10,13H2,2H3,(H2,20,21,23);1H |
| InChIKey | AAIPUIRYHWHHFD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|