C23H32FN5O3 — CID 111657636
1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111657636) has the molecular formula C23H32FN5O3 and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111657636 |
| Molecular Formula | C23H32FN5O3 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Oc2cccc(F)c2)nc1)NCC(C)(O)CN1CCOCC1 |
| InChI | InChI=1S/C23H32FN5O3/c1-3-25-22(28-16-23(2,30)17-29-9-11-31-12-10-29)27-15-18-7-8-21(26-14-18)32-20-6-4-5-19(24)13-20/h4-8,13-14,30H,3,9-12,15-17H2,1-2H3,(H2,25,27,28) |
| InChIKey | WNCORAFPMLMUID-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|