C23H32FN5O2 — CID 111314174
1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine (PubChem CID 111314174) has the molecular formula C23H32FN5O2 and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111314174 |
| Molecular Formula | C23H32FN5O2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 1-ethyl-2-[[6-(3-fluorophenoxy)-3-pyridinyl]methyl]-3-(2-methyl-2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Oc2cccc(F)c2)nc1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C23H32FN5O2/c1-4-25-22(28-17-23(2,3)29-10-12-30-13-11-29)27-16-18-8-9-21(26-15-18)31-20-7-5-6-19(24)14-20/h5-9,14-15H,4,10-13,16-17H2,1-3H3,(H2,25,27,28) |
| InChIKey | IXVYOSCKIOXEQB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|