C20H35FIN5O2 — CID 111658093
2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111658093) has the molecular formula C20H35FIN5O2 and a molecular weight of 523.44 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111658093 |
| Molecular Formula | C20H35FIN5O2 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 2-[[4-(dimethylamino)-3-fluorophenyl]methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N(C)C)c(F)c1)NCC(C)(O)CN1CCOCC1.I |
| InChI | InChI=1S/C20H34FN5O2.HI/c1-5-22-19(23-13-16-6-7-18(25(3)4)17(21)12-16)24-14-20(2,27)15-26-8-10-28-11-9-26;/h6-7,12,27H,5,8-11,13-15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | GCDNQWHEHFVLJP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|