C20H34IN5O4 — CID 111657355
methyl N-[4-[[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111657355) has the molecular formula C20H34IN5O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is methyl N-[4-[[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111657355 |
| Molecular Formula | C20H34IN5O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | methyl N-[4-[[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)OC)cc1)NCC(C)(O)CN1CCOCC1.I |
| InChI | InChI=1S/C20H33N5O4.HI/c1-4-21-18(23-14-20(2,27)15-25-9-11-29-12-10-25)22-13-16-5-7-17(8-6-16)24-19(26)28-3;/h5-8,27H,4,9-15H2,1-3H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | WTCQJKYXJDGNLI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|