C25H43N5O2 — CID 111657280
1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111657280) has the molecular formula C25H43N5O2 and a molecular weight of 445.65 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111657280 |
| Molecular Formula | C25H43N5O2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.34 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CN2CCC(C)CC2)cc1)NCC(C)(O)CN1CCOCC1 |
| InChI | InChI=1S/C25H43N5O2/c1-4-26-24(28-19-25(3,31)20-30-13-15-32-16-14-30)27-17-22-5-7-23(8-6-22)18-29-11-9-21(2)10-12-29/h5-8,21,31H,4,9-20H2,1-3H3,(H2,26,27,28) |
| InChIKey | DQMQQCYGWRHLJW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|