C22H34N6O2 — CID 111658636
2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine (PubChem CID 111658636) has the molecular formula C22H34N6O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111658636 |
| Molecular Formula | C22H34N6O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | 2-[(1-benzylpyrazol-4-yl)methyl]-1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1cnn(Cc2ccccc2)c1)NCC(C)(O)CN1CCOCC1 |
| InChI | InChI=1S/C22H34N6O2/c1-3-23-21(25-17-22(2,29)18-27-9-11-30-12-10-27)24-13-20-14-26-28(16-20)15-19-7-5-4-6-8-19/h4-8,14,16,29H,3,9-13,15,17-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | GKGUANAHBWODOM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|