C21H32N6O2 — CID 111657648
1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[(1-phenylpyrazol-3-yl)methyl]guanidine (PubChem CID 111657648) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[(1-phenylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111657648 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccn(-c2ccccc2)n1)NCC(C)(O)CN1CCOCC1 |
| InChI | InChI=1S/C21H32N6O2/c1-3-22-20(24-16-21(2,28)17-26-11-13-29-14-12-26)23-15-18-9-10-27(25-18)19-7-5-4-6-8-19/h4-10,28H,3,11-17H2,1-2H3,(H2,22,23,24) |
| InChIKey | LKORNHOZDVWHLX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|