C19H31FIN5O3 — CID 111658287
2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111658287) has the molecular formula C19H31FIN5O3 and a molecular weight of 523.39 g/mol. Its IUPAC name is 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111658287 |
| Molecular Formula | C19H31FIN5O3 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)NCC(C)(O)CN1CCOCC1.I |
| InChI | InChI=1S/C19H30FN5O3.HI/c1-3-21-18(22-12-17(26)24-16-6-4-15(20)5-7-16)23-13-19(2,27)14-25-8-10-28-11-9-25;/h4-7,27H,3,8-14H2,1-2H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | ITIZTCLMEVIIRF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|