C18H30N6O3 — CID 111658948
2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-pyridin-3-ylacetamide (PubChem CID 111658948) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-pyridin-3-ylacetamide.
| Compound Name | 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 111658948 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-[[ethylamino-[(2-hydroxy-2-methyl-3-morpholin-4-ylpropyl)amino]methylidene]amino]-N-pyridin-3-ylacetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NCC(C)(O)CN1CCOCC1 |
| InChI | InChI=1S/C18H30N6O3/c1-3-20-17(21-12-16(25)23-15-5-4-6-19-11-15)22-13-18(2,26)14-24-7-9-27-10-8-24/h4-6,11,26H,3,7-10,12-14H2,1-2H3,(H,23,25)(H2,20,21,22) |
| InChIKey | YGWONGQKNQAMEI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|