C13H22IN5O — CID 111127008
2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 111127008) has the molecular formula C13H22IN5O and a molecular weight of 391.26 g/mol. Its IUPAC name is 2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111127008 |
| Molecular Formula | C13H22IN5O |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[[ethylamino-(propan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NC(C)C.I |
| InChI | InChI=1S/C13H21N5O.HI/c1-4-15-13(17-10(2)3)16-9-12(19)18-11-6-5-7-14-8-11;/h5-8,10H,4,9H2,1-3H3,(H,18,19)(H2,15,16,17);1H |
| InChIKey | AYDOPLJFRPAUMQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|