C19H30N6O2 — CID 111569771
1-[[[N-ethyl-N'-[2-oxo-2-(pyridin-3-ylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111569771) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[2-oxo-2-(pyridin-3-ylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-ethyl-N'-[2-oxo-2-(pyridin-3-ylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569771 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-[[[N-ethyl-N'-[2-oxo-2-(pyridin-3-ylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccnc1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C19H30N6O2/c1-4-21-18(22-13-16(26)24-15-8-7-11-20-12-15)23-14-19(9-5-6-10-19)17(27)25(2)3/h7-8,11-12H,4-6,9-10,13-14H2,1-3H3,(H,24,26)(H2,21,22,23) |
| InChIKey | DMYCBBYJSORWGX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|