C17H33N5O2 — CID 111569735
1-[[[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111569735) has the molecular formula C17H33N5O2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-[[[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111569735 |
| Molecular Formula | C17H33N5O2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | 1-[[[N-ethyl-N'-[2-oxo-2-(propylamino)ethyl]carbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C17H33N5O2/c1-5-11-19-14(23)12-20-16(18-6-2)21-13-17(9-7-8-10-17)15(24)22(3)4/h5-13H2,1-4H3,(H,19,23)(H2,18,20,21) |
| InChIKey | WATZFDSUEFEWDE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|